Question

response too large

0

Why does my request return a lot of data, I define a button to do excel import, execute startImportByTemplate in the microflow, do some other activities, but there is no refresh client,I import 8000+ data , the response size too large,in the response json, there is too much ‘changes’ and ‘objects’{ "actionResult": null, "changes": { "4222124650663142": { "InventoryCode": { "value": "BatchImportTem20230106040131" }, "changedDate": { "hash": "0fpYkN6A7DJM8pxTEfav8w06Y52BoEmqyoWunvc+OT8=", "value": 1672992091304 }, "System.changedBy": { "hash": "nVH7yE3feacZQdW+nxWFBxKKW+ATomz8f9onrbMjAho=", "value": "281474976710657" }, "MasterDataMgt.TempCompoundParent_Inventory": { "hash": "qPmVLJ8DpwcWeopGEll5bjDDyam8LtjXWdvyhCtXhbU=", "value": "33776997205281122" } }, "4222124650661742": { "changedDate": { "hash": "pl4Sfjnu0zYG7nkZTAPavQED4yuSKRm5jrjEGBVF7T8=", "value": 1672992091287 } }, "33776997205281121": { "MasterDataMgt.TempCompoundParent_Template": { "hash": "feryrVSZ3c/WMk3EPOP2VtZxzrnYLGWZeMv/eRKrWo4=", "value": null } }, "6192449487879036": { "CompoundID": { "value": "908350-80-1" }, "System.changedBy": { "hash": "6bApt4ArG2iEh0z1GADvBDQNI4FTjnenb8RhoePDnQU=", "value": "281474976710657" }, "AvailableStockMg": { "value": "86" }, "changedDate": { "hash": "KPshEyrTI+JoUGNTUowm3CpU/DBufvI1Mwj/CNMw1io=", "value": 1672992091501 }, "MasterDataMgt.Compounds_TempCompoundParent_2": { "hash": "OKVszaMLdHJoPpkmBQOCqK2ch+Z+/MIehXesjN/BNFI=", "value": "33776997205281122" }, "BatchID": { "value": "0J2KRNKH" } }, "33776997205281122": { "importCount": { "value": "2" }, "MasterDataMgt.TempCompoundParent_Template": { "hash": "/CHIui3xm9rQ9WxGbSXXzAAzF5M9iNAHuY6GUKusJLc=", "value": "31243722414884017" }, "MasterDataMgt.TempCompoundParent_Inventory": { "hash": "FwFYmBw9CUjWaPI1oLL/ZnWBvwzRfmcsOgnXp+WoztA=", "value": "4222124650663142" } }, "6192449487879035": { "CompoundID": { "value": "908350-80-1" }, "System.changedBy": { "hash": "MbK/ygOGQ9RJs6p6xHq+YoIkJmAjqL6YQ+1keUk0VCU=", "value": "281474976710657" }, "AvailableStockMg": { "value": "986" }, "changedDate": { "hash": "u6XweAWijnTt9ERF3AwGPNl/ESFOEJ1kOh2NlT8KmkY=", "value": 1672992091501 }, "MasterDataMgt.Compounds_TempCompoundParent_2": { "hash": "gNFra4XddLK7ZJnlLrRhB75X+SoLX7WYZeG5eV3f8kw=", "value": "33776997205281122" }, "BatchID": { "value": "06DDLREX" } }, "31243722414884017": { "MasterDataMgt.TempCompoundParent_Template": { "hash": "liNBhLx8GGN7qZsTwHiyKkowG0OmXJ4Z8kSk3oRbmjk=", "value": "33776997205281122" } } }, "commits": ["6192449487879036", "6192449487879035"], "committedObjectsOmitted": false, "deletes": [], "instructions": [{ "args": { "FormTarget": "modal", "FormEntity": "MasterDataMgt.TempCompoundParent", "FormWidth": 0, "FormGuid": "33776997205281122", "FormPath": "MasterDataMgt/CompoundValidationBeforeImportPage.page.xml", "FormResizable": true, "FormHeight": 0, "FormName": "MasterDataMgt.CompoundValidationBeforeImportPage" }, "target": "system", "type": "open_form" }, { "args": { "NumberOfPagesToClose": 1 }, "target": "system", "type": "close" }], "newpersistable": ["4222124650663142", "6192449487879036", "33776997205281122", "6192449487879035"], "objects": [{ "attributes": { "RegisterDate": { "value": null }, "ContainerType": { "value": null }, "Remark4": { "value": "安耐吉" }, "AvailableStockMg": { "value": "0" }, "FW": { "value": "262.11" }, "SolubilizedDate": { "value": null }, "GrossWeightMG": { "value": "0" }, "MasterDataMgt.Compounds_ExcelFiles": { "value": null }, "Well": { "value": null }, "CompoundID": { "value": "908350-80-1" }, "Reason": { "value": null }, "Purity": { "value": "97" }, "Location": { "value": "F01-13-A-C02" }, "TareWeightMG": { "value": "0" }, "PurityDate": { "value": null }, "Remark5": { "value": "SF1387944308174" }, "Solution": { "value": false }, "MasterDataMgt.Compounds_Inventory": { "value": "4222124650663142" }, "StockVolumeUL": { "value": null }, "RackID": { "value": null }, "StockAmountMG": { "value": "86" }, "System.changedBy": { "value": "281474976710657", "readonly": true }, "Remark9": { "value": "4-硼酸频哪醇酯基-1-(三氟甲基)-1H-吡唑" }, "CompoundStatus": { "value": "Available" }, "PurityMethod": { "value": null }, "Remark2": { "value": "4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trifluoromethyl)-1H-pyrazole" }, "ContainerID": { "value": "411100002" }, "Remark8": { "value": null }, "MasterDataMgt.Compounds_TempBatchImport": { "value": null }, "System.owner": { "value": "281474976710657", "readonly": true }, "InitialAmountMG": { "value": "100" }, "Remark7": { "value": null }, "MW": { "value": "262.11" }, "ExactMass": { "value": "0" }, "Source": { "value": null }, "MasterDataMgt.Compounds_SearchHelper": { "value": null }, "ReceivedDate": { "value": 1662307200000 }, "SaltMole": { "value": "0" }, "Remark1": { "value": null }, "MasterDataMgt.Compounds_TempCompoundParent_2": { "value": null }, "BatchID": { "value": "0J2KRNKH" }, "NoSolution": { "value": false }, "PhysicalCharacter": { "value": "Solid" }, "Remark3": { "value": "Boric Acid" }, "Solvent": { "value": null }, "Smiles": { "value": "B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(F)(F)F" }, "Remark10": { "value": null }, "Remark6": { "value": "BB" }, "SaltForm": { "value": "free" }, "changedDate": { "value": 1672992091000, "readonly": true }, "ProjectCode": { "value": null }, "ConcentrationMM": { "value": null }, "MasterDataMgt.Compounds_Session": { "value": null }, "createdDate": { "value": 1672992091000, "readonly": true } }, "guid": "6192449487879036", "hash": "wj05vpMijzehUIbkO01py89dyJDKn1hQGQy0aWHw53Q=", "objectType": "MasterDataMgt.Compounds" }, { "attributes": { "RegisterDate": { "value": null }, "ContainerType": { "value": null }, "Remark4": { "value": "安耐吉" }, "AvailableStockMg": { "value": "0" }, "FW": { "value": "281.16" }, "SolubilizedDate": { "value": null }, "GrossWeightMG": { "value": "0" }, "MasterDataMgt.Compounds_ExcelFiles": { "value": null }, "Well": { "value": null }, "CompoundID": { "value": "908350-80-1" }, "Reason": { "value": null }, "Purity": { "value": "98" }, "Location": { "value": "F01-11-C-D03" }, "TareWeightMG": { "value": "0" }, "PurityDate": { "value": null }, "Remark5": { "value": "SF1387944308174" }, "Solution": { "value": false }, "MasterDataMgt.Compounds_Inventory": { "value": "4222124650663142" }, "StockVolumeUL": { "value": null }, "RackID": { "value": null }, "StockAmountMG": { "value": "986" }, "System.changedBy": { "value": "281474976710657", "readonly": true }, "Remark9": { "value": "4-(2-吡啶基)苯硼酸频哪醇酯" }, "CompoundStatus": { "value": "Available" }, "PurityMethod": { "value": null }, "Remark2": { "value": "2-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)pyridine" }, "ContainerID": { "value": "411100001" }, "Remark8": { "value": null }, "MasterDataMgt.Compounds_TempBatchImport": { "value": null }, "System.owner": { "value": "281474976710657", "readonly": true }, "InitialAmountMG": { "value": "1000" }, "Remark7": { "value": null }, "MW": { "value": "281.16" }, "ExactMass": { "value": "0" }, "Source": { "value": null }, "MasterDataMgt.Compounds_SearchHelper": { "value": null }, "ReceivedDate": { "value": 1662307200000 }, "SaltMole": { "value": "0" }, "Remark1": { "value": null }, "MasterDataMgt.Compounds_TempCompoundParent_2": { "value": null }, "BatchID": { "value": "06DDLREX" }, "NoSolution": { "value": false }, "PhysicalCharacter": { "value": "Solid" }, "Remark3": { "value": "Boric Acid" }, "Solvent": { "value": null }, "Smiles": { "value": "CC1(OB(C2=CC=C(C3=NC=CC=C3)C=C2)OC1(C)C)C" }, "Remark10": { "value": null }, "Remark6": { "value": "BB" }, "SaltForm": { "value": "free" }, "changedDate": { "value": 1672992091000, "readonly": true }, "ProjectCode": { "value": null }, "ConcentrationMM": { "value": null }, "MasterDataMgt.Compounds_Session": { "value": null }, "createdDate": { "value": 1672992091000, "readonly": true } }, "guid": "6192449487879035", "hash": "vQYDDUdhz3wmJNWtEz0ojGcQjTFht9u+uNxtY5/h+0k=", "objectType": "MasterDataMgt.Compounds" }, { "attributes": { "MasterDataMgt.Inventory_TemplateDocument": { "value": null }, "AliasProjectCode": { "value": "Project Code" }, "AddonFunctions.InventorySelected_Inventory": { "value": null }, "AliasGrossWeight": { "value": "Gross Weight (mg)" }, "AliasContainerID": { "value": "Container ID" }, "AilasRemark2": { "value": "Remark2" }, "AliasSolubilizedDate": { "value": "Solubilized Date" }, "MasterDataMgt.Inventory_Account_Owner": { "value": null }, "AliasPurityDate": { "value": "Purity Date" }, "AliasPurity": { "value": "Purity" }, "MasterDataMgt.Inventory_Warehouse": { "value": null }, "AilasProjectCode": { "value": "Projcet Code" }, "AilasRemark3": { "value": "Remark3" }, "System.changedBy": { "value": null, "readonly": true }, "MasterDataMgt.Inventory_AdvancedExcel": { "value": null }, "AliasContainerType": { "value": "Container Type" }, "AliasConcentration": { "value": "Concentration" }, "AliasSource": { "value": "Source" }, "InventoryName": { "value": null }, "AliasSmiles": { "value": "Smiles" }, "AilasRemark8": { "value": "Remark8" }, "MasterDataMgt.TempCompoundParent_Inventory": { "value": null }, "AilasRemark6": { "value": "Remark6" }, "AliasFW": { "value": "FW" }, "AliasMW": { "value": "MW" }, "AilasRemark10": { "value": "Remark10" }, "AliasInitialAmount": { "value": "Initial Amount (mg)" }, "AliasBatchID": { "value": "Batch ID" }, "AliasRackID": { "value": "Rack ID" }, "AliasPurityMethod": { "value": "Purity Method" }, "AliasLocation": { "value": "Location" }, "System.owner": { "value": "281474976710657", "readonly": true }, "AliasPhysicalCharacter": { "value": "PhysicalCharacter" }, "AilasRemark9": { "value": "Remark9" }, "AliasCompoundID": { "value": "Compound ID" }, "AliasSaltForm": { "value": "Salt Form" }, "AliasExactMass": { "value": "Exact Mass" }, "AliasTareWeight": { "value": "Tare Weight (mg)" }, "MasterDataMgt.Inventory_Account_Customer": { "value": null }, "AliasReceivedDate": { "value": "Received Date" }, "AliasWell": { "value": "Well" }, "AilasRemark5": { "value": "Remark5" }, "AilasRemark7": { "value": "Remark7" }, "AliasSaltMole": { "value": "Salt Mole" }, "AliasSolvent": { "value": "Solvent" }, "InventoryCode": { "value": null }, "changedDate": { "value": null, "readonly": true }, "AliasStockAmount": { "value": "Stock Amount (mg)" }, "AilasRemark4": { "value": "Remark4" }, "AliasStockVolume": { "value": "Stock Volume (μL)" }, "createdDate": { "value": 1672992091303, "readonly": true }, "AilasRemark1": { "value": "Remark1" } }, "guid": "4222124650663142", "hash": "WBVO4AXJXAKYNUevHQBoFgK4N3lZpJEfsrt4kePlJ3U=", "objectType": "MasterDataMgt.Inventory" }, { "attributes": { "importCount": { "value": "0" }, "MasterDataMgt.TempCompoundParent_Session": { "value": null }, "MasterDataMgt.TempCompoundParent_Template": { "value": null }, "MasterDataMgt.TempCompoundParent_Inventory": { "value": null } }, "guid": "33776997205281122", "hash": "2QVUykvqWkfmQzQelDAcJDLBj1/Eme6KiPPxGoQnQaE=", "objectType": "MasterDataMgt.TempCompoundParent" }, { "attributes": { "ExcelImporter.Template_MxObjectType": { "value": "13792273858822153" }, "System.changedBy": { "value": "281474976710657", "readonly": true }, "Description": { "value": null }, "FirstDataRowNumber": { "value": "2" }, "ImportAction": { "value": "CreateObjects" }, "System.owner": { "value": "281474976710657", "readonly": true }, "ExcelImporter.Template_AdditionalProperties": { "value": "7599824371188913" }, "HeaderRowNumber": { "value": "1" }, "ExcelImporter.Template_Inventory": { "value": "4222124650661742" }, "Title": { "value": "inbound-large2" }, "ExcelImporter.Template_MxObjectReference_ParentAssociation": { "value": "844424930131973" }, "SheetIndex": { "value": "1" }, "TemplateType": { "value": "Normal" }, "MasterDataMgt.TempCompoundParent_Template": { "value": "33776997205280721" }, "ExcelImporter.Template_MasterTemplate": { "value": null }, "changedDate": { "value": 1672910424000, "readonly": true }, "Nr": { "value": "22", "readonly": true }, "Status": { "value": "VALID" }, "createdDate": { "value": 1672910414000, "readonly": true } }, "guid": "31243722414884017", "hash": "OYTIrRvJJ0GmkTYZRz/Nid+7lQmdqiy1XHD8q3jGMdc=", "objectType": "ExcelImporter.Template" }], "resets": {} }

asked 2023-01-06

guan jiajie

1 answers

Chris de Gelder · Accepted Answer · 2023-01-06

Mendix will often return all data used in a microflow, even when not needed in the page. You can do a couple of things to prevent that:

Don’t use associations from the context or the template (like TempCompoundParent_Template)
Clear lists after commit